C13H16INO4S — CID 146365973
2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 3-iodobenzoate (PubChem CID 146365973) has the molecular formula C13H16INO4S and a molecular weight of 409.25 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 3-iodobenzoate.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 3-iodobenzoate |
|---|---|
| PubChem CID | 146365973 |
| Molecular Formula | C13H16INO4S |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl 3-iodobenzoate |
| SMILES | O=C(OCCN1CCS(=O)(=O)CC1)c1cccc(I)c1 |
| InChI | InChI=1S/C13H16INO4S/c14-12-3-1-2-11(10-12)13(16)19-7-4-15-5-8-20(17,18)9-6-15/h1-3,10H,4-9H2 |
| InChIKey | PHCXBNCRDXUCQC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|