C13H19INO4+ — CID 155784818
bis(2-hydroxyethyl)-[2-(3-iodobenzoyl)oxyethyl]azanium (PubChem CID 155784818) has the molecular formula C13H19INO4+ and a molecular weight of 380.20 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-[2-(3-iodobenzoyl)oxyethyl]azanium.
| Compound Name | bis(2-hydroxyethyl)-[2-(3-iodobenzoyl)oxyethyl]azanium |
|---|---|
| PubChem CID | 155784818 |
| Molecular Formula | C13H19INO4+ |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | bis(2-hydroxyethyl)-[2-(3-iodobenzoyl)oxyethyl]azanium |
| SMILES | O=C(OCC[NH+](CCO)CCO)c1cccc(I)c1 |
| InChI | InChI=1S/C13H18INO4/c14-12-3-1-2-11(10-12)13(18)19-9-6-15(4-7-16)5-8-17/h1-3,10,16-17H,4-9H2/p+1 |
| InChIKey | AEBAYBBWJXVQSF-UHFFFAOYSA-O |
| XLogP | -0.68 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|