C27H58O3Si2 — CID 10624815
(E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-en-1-ol (PubChem CID 10624815) has the molecular formula C27H58O3Si2 and a molecular weight of 486.93 g/mol. Its IUPAC name is (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-en-1-ol.
| Compound Name | (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-en-1-ol |
|---|---|
| PubChem CID | 10624815 |
| Molecular Formula | C27H58O3Si2 |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.39 |
| IUPAC Name | (E,3R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,4-trimethyldodec-4-en-1-ol |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H58O3Si2/c1-15-16-17-18-23(29-31(11,12)25(3,4)5)20-19-22(2)24(27(9,10)21-28)30-32(13,14)26(6,7)8/h19,23-24,28H,15-18,20-21H2,1-14H3/b22-19+/t23-,24-/m1/s1 |
| InChIKey | VJCMMRKKIAWZGZ-OGDAOFCMSA-N |
| XLogP | 8.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|