C8H12I2Te — CID 10624897
(1E,3Z)-4-butyltellanyl-1,2-diiodobuta-1,3-diene (PubChem CID 10624897) has the molecular formula C8H12I2Te and a molecular weight of 489.59 g/mol. Its IUPAC name is (1E,3Z)-4-butyltellanyl-1,2-diiodobuta-1,3-diene.
| Compound Name | (1E,3Z)-4-butyltellanyl-1,2-diiodobuta-1,3-diene |
|---|---|
| PubChem CID | 10624897 |
| Molecular Formula | C8H12I2Te |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 491.81 |
| IUPAC Name | (1E,3Z)-4-butyltellanyl-1,2-diiodobuta-1,3-diene |
| SMILES | CCCC[Te]/C=C\C(I)=C/I |
| InChI | InChI=1S/C8H12I2Te/c1-2-3-5-11-6-4-8(10)7-9/h4,6-7H,2-3,5H2,1H3/b6-4-,8-7+ |
| InChIKey | FXAFMOFJDQQRHX-IQTBQJLQSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|