C34H24O4 — CID 10625080
2-benzoyl-3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-6-phenylfuro[3,2-g]chromen-7-one (PubChem CID 10625080) has the molecular formula C34H24O4 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-benzoyl-3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-6-phenylfuro[3,2-g]chromen-7-one.
| Compound Name | 2-benzoyl-3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-6-phenylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 10625080 |
| Molecular Formula | C34H24O4 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-benzoyl-3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]-6-phenylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1ccc(/C=C/c2c(-c3ccccc3)c(=O)oc3cc4oc(C(=O)c5ccccc5)c(C)c4cc23)cc1 |
| InChI | InChI=1S/C34H24O4/c1-21-13-15-23(16-14-21)17-18-26-28-19-27-22(2)33(32(35)25-11-7-4-8-12-25)37-29(27)20-30(28)38-34(36)31(26)24-9-5-3-6-10-24/h3-20H,1-2H3/b18-17+ |
| InChIKey | QCDQWIGGLVJXBF-ISLYRVAYSA-N |
| XLogP | 8.22 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|