C33H22O4 — CID 10790956
2-benzoyl-3-methyl-6-phenyl-5-[(E)-2-phenylethenyl]furo[3,2-g]chromen-7-one (PubChem CID 10790956) has the molecular formula C33H22O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-benzoyl-3-methyl-6-phenyl-5-[(E)-2-phenylethenyl]furo[3,2-g]chromen-7-one.
| Compound Name | 2-benzoyl-3-methyl-6-phenyl-5-[(E)-2-phenylethenyl]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 10790956 |
| Molecular Formula | C33H22O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-benzoyl-3-methyl-6-phenyl-5-[(E)-2-phenylethenyl]furo[3,2-g]chromen-7-one |
| SMILES | Cc1c(C(=O)c2ccccc2)oc2cc3oc(=O)c(-c4ccccc4)c(/C=C/c4ccccc4)c3cc12 |
| InChI | InChI=1S/C33H22O4/c1-21-26-19-27-25(18-17-22-11-5-2-6-12-22)30(23-13-7-3-8-14-23)33(35)37-29(27)20-28(26)36-32(21)31(34)24-15-9-4-10-16-24/h2-20H,1H3/b18-17+ |
| InChIKey | XPPNMVMZEFDWAB-ISLYRVAYSA-N |
| XLogP | 7.92 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|