C34H31NO5 — CID 10626126
2-O-benzhydryl 1-O-benzyl (2S,5S)-5-benzyl-6-oxopiperidine-1,2-dicarboxylate (PubChem CID 10626126) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-O-benzhydryl 1-O-benzyl (2S,5S)-5-benzyl-6-oxopiperidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzhydryl 1-O-benzyl (2S,5S)-5-benzyl-6-oxopiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10626126 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-O-benzhydryl 1-O-benzyl (2S,5S)-5-benzyl-6-oxopiperidine-1,2-dicarboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)[C@@H]1CC[C@@H](Cc2ccccc2)C(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H31NO5/c36-32-29(23-25-13-5-1-6-14-25)21-22-30(35(32)34(38)39-24-26-15-7-2-8-16-26)33(37)40-31(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-31H,21-24H2/t29-,30-/m0/s1 |
| InChIKey | IFMGOUWXQDJUNK-KYJUHHDHSA-N |
| XLogP | 6.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |