C28H53N5O5 — CID 10626254
(3S,6S,12R,13R)-6-(4-aminobutyl)-13-decyl-3-(2,2-dimethylpropyl)-12-hydroxy-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone (PubChem CID 10626254) has the molecular formula C28H53N5O5 and a molecular weight of 539.76 g/mol. Its IUPAC name is (3S,6S,12R,13R)-6-(4-aminobutyl)-13-decyl-3-(2,2-dimethylpropyl)-12-hydroxy-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,12R,13R)-6-(4-aminobutyl)-13-decyl-3-(2,2-dimethylpropyl)-12-hydroxy-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 10626254 |
| Molecular Formula | C28H53N5O5 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | (3S,6S,12R,13R)-6-(4-aminobutyl)-13-decyl-3-(2,2-dimethylpropyl)-12-hydroxy-1,4,7,10-tetrazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCCCCCCC[C@H]1NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H]1O |
| InChI | InChI=1S/C28H53N5O5/c1-5-6-7-8-9-10-11-12-15-20-24(35)27(38)30-19-23(34)31-21(16-13-14-17-29)25(36)33-22(26(37)32-20)18-28(2,3)4/h20-22,24,35H,5-19,29H2,1-4H3,(H,30,38)(H,31,34)(H,32,37)(H,33,36)/t20-,21+,22+,24-/m1/s1 |
| InChIKey | LQOIIHFGOWJFRU-HOUBMWHVSA-N |
| XLogP | 2.03 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|