C30H46O7S — CID 10626503
methyl (1S,3R,6S,7S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methyl-4-oxohept-5-en-2-yl]-6-sulfooxypentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate (PubChem CID 10626503) has the molecular formula C30H46O7S and a molecular weight of 550.76 g/mol. Its IUPAC name is methyl (1S,3R,6S,7S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methyl-4-oxohept-5-en-2-yl]-6-sulfooxypentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate.
| Compound Name | methyl (1S,3R,6S,7S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methyl-4-oxohept-5-en-2-yl]-6-sulfooxypentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
|---|---|
| PubChem CID | 10626503 |
| Molecular Formula | C30H46O7S |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | methyl (1S,3R,6S,7S,11S,12S,15R,16R)-12,16-dimethyl-15-[(2R)-6-methyl-4-oxohept-5-en-2-yl]-6-sulfooxypentacyclo[9.7.0.01,3.03,8.012,16]octadecane-7-carboxylate |
| SMILES | COC(=O)[C@H]1C2CC[C@@H]3[C@]4(CC[C@]5(C)[C@@H]([C@H](C)CC(=O)C=C(C)C)CC[C@@]35C)C[C@]24CC[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C30H46O7S/c1-18(2)15-20(31)16-19(3)21-9-11-28(5)24-8-7-22-25(26(32)36-6)23(37-38(33,34)35)10-12-29(22)17-30(24,29)14-13-27(21,28)4/h15,19,21-25H,7-14,16-17H2,1-6H3,(H,33,34,35)/t19-,21-,22?,23+,24+,25+,27-,28+,29-,30+/m1/s1 |
| InChIKey | WBSKPNZULYXHAJ-IOIPZVAPSA-N |
| XLogP | 5.94 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|