C30H48O7S — CID 10792815
methyl (3S,4S,10S,13R,14R,17R)-17-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-10,13,14-trimethyl-3-sulfooxy-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate (PubChem CID 10792815) has the molecular formula C30H48O7S and a molecular weight of 552.77 g/mol. Its IUPAC name is methyl (3S,4S,10S,13R,14R,17R)-17-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-10,13,14-trimethyl-3-sulfooxy-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate.
| Compound Name | methyl (3S,4S,10S,13R,14R,17R)-17-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-10,13,14-trimethyl-3-sulfooxy-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate |
|---|---|
| PubChem CID | 10792815 |
| Molecular Formula | C30H48O7S |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | methyl (3S,4S,10S,13R,14R,17R)-17-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-10,13,14-trimethyl-3-sulfooxy-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-4-carboxylate |
| SMILES | COC(=O)[C@H]1C2CCC3=C(CC[C@]4(C)[C@@H]([C@H](C)C[C@@H](O)C=C(C)C)CC[C@@]34C)[C@@]2(C)CC[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C30H48O7S/c1-18(2)16-20(31)17-19(3)21-10-14-30(6)23-8-9-24-26(27(32)36-7)25(37-38(33,34)35)12-13-28(24,4)22(23)11-15-29(21,30)5/h16,19-21,24-26,31H,8-15,17H2,1-7H3,(H,33,34,35)/t19-,20+,21-,24?,25+,26+,28-,29-,30+/m1/s1 |
| InChIKey | CJTOMRNUZCVNGX-GSQMWDSUSA-N |
| XLogP | 6.04 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|