C30H52O9S2 — CID 22832954
[(1S,3R,6S,7R,8S,11S,12S,15R,16R)-15-(4-hydroxy-6-methylheptan-2-yl)-7,12,16-trimethyl-7-(sulfooxymethyl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] hydrogen sulfate (PubChem CID 22832954) has the molecular formula C30H52O9S2 and a molecular weight of 620.87 g/mol. Its IUPAC name is [(1S,3R,6S,7R,8S,11S,12S,15R,16R)-15-(4-hydroxy-6-methylheptan-2-yl)-7,12,16-trimethyl-7-(sulfooxymethyl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] hydrogen sulfate.
| Compound Name | [(1S,3R,6S,7R,8S,11S,12S,15R,16R)-15-(4-hydroxy-6-methylheptan-2-yl)-7,12,16-trimethyl-7-(sulfooxymethyl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] hydrogen sulfate |
|---|---|
| PubChem CID | 22832954 |
| Molecular Formula | C30H52O9S2 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | [(1S,3R,6S,7R,8S,11S,12S,15R,16R)-15-(4-hydroxy-6-methylheptan-2-yl)-7,12,16-trimethyl-7-(sulfooxymethyl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] hydrogen sulfate |
| SMILES | CC(C)CC(O)CC(C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@@H]4[C@](C)(COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C30H52O9S2/c1-19(2)15-21(31)16-20(3)22-9-11-28(6)24-8-7-23-26(4,18-38-40(32,33)34)25(39-41(35,36)37)10-12-29(23)17-30(24,29)14-13-27(22,28)5/h19-25,31H,7-18H2,1-6H3,(H,32,33,34)(H,35,36,37)/t20?,21?,22-,23-,24+,25+,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | RFWHVAYSAVHGRZ-VBATWABUSA-N |
| XLogP | 5.85 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|