C30H49O6S- — CID 171119649
[(1S,3R,6S,7R,11S,12S,15R,16R)-7-(hydroxymethyl)-15-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] sulfate (PubChem CID 171119649) has the molecular formula C30H49O6S- and a molecular weight of 537.78 g/mol. Its IUPAC name is [(1S,3R,6S,7R,11S,12S,15R,16R)-7-(hydroxymethyl)-15-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] sulfate.
| Compound Name | [(1S,3R,6S,7R,11S,12S,15R,16R)-7-(hydroxymethyl)-15-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] sulfate |
|---|---|
| PubChem CID | 171119649 |
| Molecular Formula | C30H49O6S- |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | [(1S,3R,6S,7R,11S,12S,15R,16R)-7-(hydroxymethyl)-15-[(2R,4R)-4-hydroxy-6-methylhept-5-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] sulfate |
| SMILES | CC(C)=C[C@H](O)C[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CCC4[C@@]5(CC[C@H](OS(=O)(=O)[O-])[C@@]4(C)CO)C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C30H50O6S/c1-19(2)15-21(32)16-20(3)22-9-11-28(6)24-8-7-23-26(4,18-31)25(36-37(33,34)35)10-12-29(23)17-30(24,29)14-13-27(22,28)5/h15,20-25,31-32H,7-14,16-18H2,1-6H3,(H,33,34,35)/p-1/t20-,21+,22-,23?,24+,25+,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | BTQRGQYBCTZVTK-DNVZBWASSA-M |
| XLogP | 5.60 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|