C13H9BrF2INO — CID 106270643
1-[(3-bromo-2,6-difluorophenyl)methyl]-5-iodo-4-methylpyridin-2-one (PubChem CID 106270643) has the molecular formula C13H9BrF2INO and a molecular weight of 440.03 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-5-iodo-4-methylpyridin-2-one.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-5-iodo-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 106270643 |
| Molecular Formula | C13H9BrF2INO |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 438.89 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-5-iodo-4-methylpyridin-2-one |
| SMILES | Cc1cc(=O)n(Cc2c(F)ccc(Br)c2F)cc1I |
| InChI | InChI=1S/C13H9BrF2INO/c1-7-4-12(19)18(6-11(7)17)5-8-10(15)3-2-9(14)13(8)16/h2-4,6H,5H2,1H3 |
| InChIKey | UHNHQZPQHNTYBD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|