C16H19BrF2O — CID 106274498
1-(2-bicyclo[2.2.1]heptanyl)-3-(3-bromo-2,6-difluorophenyl)propan-2-ol (PubChem CID 106274498) has the molecular formula C16H19BrF2O and a molecular weight of 345.23 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-bromo-2,6-difluorophenyl)propan-2-ol.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-bromo-2,6-difluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 106274498 |
| Molecular Formula | C16H19BrF2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-(3-bromo-2,6-difluorophenyl)propan-2-ol |
| SMILES | OC(Cc1c(F)ccc(Br)c1F)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H19BrF2O/c17-14-3-4-15(18)13(16(14)19)8-12(20)7-11-6-9-1-2-10(11)5-9/h3-4,9-12,20H,1-2,5-8H2 |
| InChIKey | VJYPJJVHVCFZQU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|