C13H20N4O2 — CID 106278266
3-[(4-aminophenyl)carbamoylamino]-N,2,2-trimethylpropanamide (PubChem CID 106278266) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-[(4-aminophenyl)carbamoylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(4-aminophenyl)carbamoylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278266 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 3-[(4-aminophenyl)carbamoylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C13H20N4O2/c1-13(2,11(18)15-3)8-16-12(19)17-10-6-4-9(14)5-7-10/h4-7H,8,14H2,1-3H3,(H,15,18)(H2,16,17,19) |
| InChIKey | LRGXFPRWTZSZCD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|