C9H10N4O2 — CID 106281528
3-methyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione (PubChem CID 106281528) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-methyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 106281528 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-methyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(C(C)c2ncn[nH]2)C1=O |
| InChI | InChI=1S/C9H10N4O2/c1-5-3-7(14)13(9(5)15)6(2)8-10-4-11-12-8/h3-4,6H,1-2H3,(H,10,11,12) |
| InChIKey | KPHOYUDMSWEOCC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|