C9H16N4O2S — CID 106281595
1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thian-4-amine (PubChem CID 106281595) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thian-4-amine |
|---|---|
| PubChem CID | 106281595 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thian-4-amine |
| SMILES | CC(NC1CCS(=O)(=O)CC1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4O2S/c1-7(9-10-6-11-13-9)12-8-2-4-16(14,15)5-3-8/h6-8,12H,2-5H2,1H3,(H,10,11,13) |
| InChIKey | DUCAETIJTUUHGV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |