C9H16N4O4S2 — CID 103943224
1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiane-4-sulfonamide (PubChem CID 103943224) has the molecular formula C9H16N4O4S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiane-4-sulfonamide.
| Compound Name | 1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiane-4-sulfonamide |
|---|---|
| PubChem CID | 103943224 |
| Molecular Formula | C9H16N4O4S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1,1-dioxo-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]thiane-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)C1CCS(=O)(=O)CC1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4O4S2/c1-7(9-10-6-11-12-9)13-19(16,17)8-2-4-18(14,15)5-3-8/h6-8,13H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | JEDVKSGLFOTPOQ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |