C7H12N4O2S — CID 60977965
1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolan-3-amine (PubChem CID 60977965) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 60977965 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCc2ncn[nH]2)C1 |
| InChI | InChI=1S/C7H12N4O2S/c12-14(13)2-1-6(4-14)8-3-7-9-5-10-11-7/h5-6,8H,1-4H2,(H,9,10,11) |
| InChIKey | FAQHGQJTERBKSO-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |