C8H14N4O2S — CID 60979171
1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine (PubChem CID 60979171) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine.
| Compound Name | 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine |
|---|---|
| PubChem CID | 60979171 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1,1-dioxo-N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine |
| SMILES | O=S1(=O)CCC(NCc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C8H14N4O2S/c13-15(14)3-1-7(2-4-15)9-5-8-10-6-11-12-8/h6-7,9H,1-5H2,(H,10,11,12) |
| InChIKey | PVIFWTICVSUKAR-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |