C8H14N4S — CID 60979172
N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine (PubChem CID 60979172) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine |
|---|---|
| PubChem CID | 60979172 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)thian-4-amine |
| SMILES | c1n[nH]c(CNC2CCSCC2)n1 |
| InChI | InChI=1S/C8H14N4S/c1-3-13-4-2-7(1)9-5-8-10-6-11-12-8/h6-7,9H,1-5H2,(H,10,11,12) |
| InChIKey | PGNWJLBYURUFML-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |