C39H45N4O9P — CID 10628832
3-pyridin-4-ylpropyl (2S)-2-[methoxy-[(1R)-2-phenyl-1-[[(2R)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl]amino]ethyl]phosphoryl]oxy-3-phenylpropanoate (PubChem CID 10628832) has the molecular formula C39H45N4O9P and a molecular weight of 744.78 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl (2S)-2-[methoxy-[(1R)-2-phenyl-1-[[(2R)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl]amino]ethyl]phosphoryl]oxy-3-phenylpropanoate.
| Compound Name | 3-pyridin-4-ylpropyl (2S)-2-[methoxy-[(1R)-2-phenyl-1-[[(2R)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl]amino]ethyl]phosphoryl]oxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10628832 |
| Molecular Formula | C39H45N4O9P |
| Molecular Weight | 744.78 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | 3-pyridin-4-ylpropyl (2S)-2-[methoxy-[(1R)-2-phenyl-1-[[(2R)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoyl]amino]ethyl]phosphoryl]oxy-3-phenylpropanoate |
| SMILES | COP(=O)(O[C@@H](Cc1ccccc1)C(=O)OCCCc1ccncc1)[C@H](Cc1ccccc1)NC(=O)[C@@H](C)NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H45N4O9P/c1-29(42-35(44)27-41-39(47)51-28-33-17-10-5-11-18-33)37(45)43-36(26-32-15-8-4-9-16-32)53(48,49-2)52-34(25-31-13-6-3-7-14-31)38(46)50-24-12-19-30-20-22-40-23-21-30/h3-11,13-18,20-23,29,34,36H,12,19,24-28H2,1-2H3,(H,41,47)(H,42,44)(H,43,45)/t29-,34+,36-,53?/m1/s1 |
| InChIKey | KHVOGJPORIDRPA-UMLPQBCVSA-N |
| XLogP | 5.14 |
| TPSA | 171.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|