C11H17F4NO2 — CID 106290128
N-(2,2,3,3-tetrafluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 106290128) has the molecular formula C11H17F4NO2 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(2,2,3,3-tetrafluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 106290128 |
| Molecular Formula | C11H17F4NO2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(2,2,3,3-tetrafluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | FC(F)C(F)(F)CNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H17F4NO2/c12-9(13)11(14,15)7-16-8-1-3-10(4-2-8)17-5-6-18-10/h8-9,16H,1-7H2 |
| InChIKey | QXXSJHAEDDJOBB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|