C44H34O12S — CID 10629085
[(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-6-[(3R,4S)-2,5-dioxo-4-phenylsulfanyloxolan-3-yl]oxan-2-yl]methyl benzoate (PubChem CID 10629085) has the molecular formula C44H34O12S and a molecular weight of 786.81 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-6-[(3R,4S)-2,5-dioxo-4-phenylsulfanyloxolan-3-yl]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-6-[(3R,4S)-2,5-dioxo-4-phenylsulfanyloxolan-3-yl]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10629085 |
| Molecular Formula | C44H34O12S |
| Molecular Weight | 786.81 g/mol |
| Exact Mass | 786.18 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-6-[(3R,4S)-2,5-dioxo-4-phenylsulfanyloxolan-3-yl]oxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC([C@@H]2C(=O)OC(=O)[C@H]2Sc2ccccc2)C(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H34O12S/c45-39(27-16-6-1-7-17-27)51-26-32-34(53-40(46)28-18-8-2-9-19-28)36(54-41(47)29-20-10-3-11-21-29)37(55-42(48)30-22-12-4-13-23-30)35(52-32)33-38(44(50)56-43(33)49)57-31-24-14-5-15-25-31/h1-25,32-38H,26H2/t32-,33+,34-,35?,36+,37?,38+/m1/s1 |
| InChIKey | RVFFGVRWWLAIKL-QBRJGIKXSA-N |
| XLogP | 6.15 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.81 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|