C10H7F5N2O4 — CID 106293425
4-fluoro-2-nitro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid (PubChem CID 106293425) has the molecular formula C10H7F5N2O4 and a molecular weight of 314.17 g/mol. Its IUPAC name is 4-fluoro-2-nitro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid.
| Compound Name | 4-fluoro-2-nitro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid |
|---|---|
| PubChem CID | 106293425 |
| Molecular Formula | C10H7F5N2O4 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-fluoro-2-nitro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NCC(F)(F)C(F)F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F5N2O4/c11-5-2-7(17(20)21)4(8(18)19)1-6(5)16-3-10(14,15)9(12)13/h1-2,9,16H,3H2,(H,18,19) |
| InChIKey | CIWSDIHYNHBYLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|