C11H13F4N3OS — CID 106296562
3-amino-N-cyclopropyl-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide (PubChem CID 106296562) has the molecular formula C11H13F4N3OS and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-cyclopropyl-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106296562 |
| Molecular Formula | C11H13F4N3OS |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-amino-N-cyclopropyl-5-(2,2,3,3-tetrafluoropropylamino)thiophene-2-carboxamide |
| SMILES | Nc1cc(NCC(F)(F)C(F)F)sc1C(=O)NC1CC1 |
| InChI | InChI=1S/C11H13F4N3OS/c12-10(13)11(14,15)4-17-7-3-6(16)8(20-7)9(19)18-5-1-2-5/h3,5,10,17H,1-2,4,16H2,(H,18,19) |
| InChIKey | LMSPHEDATPTWTK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|