C13H18N4O2 — CID 106296931
[4-[(5-amino-1H-indazol-6-yl)amino]oxan-4-yl]methanol (PubChem CID 106296931) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is [4-[(5-amino-1H-indazol-6-yl)amino]oxan-4-yl]methanol.
| Compound Name | [4-[(5-amino-1H-indazol-6-yl)amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106296931 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [4-[(5-amino-1H-indazol-6-yl)amino]oxan-4-yl]methanol |
| SMILES | Nc1cc2cn[nH]c2cc1NC1(CO)CCOCC1 |
| InChI | InChI=1S/C13H18N4O2/c14-10-5-9-7-15-17-11(9)6-12(10)16-13(8-18)1-3-19-4-2-13/h5-7,16,18H,1-4,8,14H2,(H,15,17) |
| InChIKey | URLYWJXJMPJUMT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|