C12H18BrNO3 — CID 106307543
N-[3-(2-bromoethoxy)propyl]-2-ethylfuran-3-carboxamide (PubChem CID 106307543) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-2-ethylfuran-3-carboxamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-2-ethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106307543 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-2-ethylfuran-3-carboxamide |
| SMILES | CCc1occc1C(=O)NCCCOCCBr |
| InChI | InChI=1S/C12H18BrNO3/c1-2-11-10(4-8-17-11)12(15)14-6-3-7-16-9-5-13/h4,8H,2-3,5-7,9H2,1H3,(H,14,15) |
| InChIKey | VHCUGGBHLFQVRY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|