C16H22N2 — CID 106314935
7-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 106314935) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 7-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 106314935 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 7-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC1=CCCN(Cc2ccc3c(c2)CNCC3)C1 |
| InChI | InChI=1S/C16H22N2/c1-13-3-2-8-18(11-13)12-14-4-5-15-6-7-17-10-16(15)9-14/h3-5,9,17H,2,6-8,10-12H2,1H3 |
| InChIKey | AHWAKXUNLIGHHX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|