C14H15N3O2S — CID 106315593
(E)-3-[6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid (PubChem CID 106315593) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is (E)-3-[6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106315593 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (E)-3-[6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
| SMILES | CC1=CCCN(c2nc3sccn3c2/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C14H15N3O2S/c1-10-3-2-6-16(9-10)13-11(4-5-12(18)19)17-7-8-20-14(17)15-13/h3-5,7-8H,2,6,9H2,1H3,(H,18,19)/b5-4+ |
| InChIKey | PLEYTMYRHPBSBV-SNAWJCMRSA-N |
| XLogP | 2.65 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|