C12H10N4O4S — CID 77111303
3-[6-(3,5-dioxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid (PubChem CID 77111303) has the molecular formula C12H10N4O4S and a molecular weight of 306.30 g/mol. Its IUPAC name is 3-[6-(3,5-dioxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[6-(3,5-dioxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77111303 |
| Molecular Formula | C12H10N4O4S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-[6-(3,5-dioxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1c(N2CC(=O)NC(=O)C2)nc2sccn12 |
| InChI | InChI=1S/C12H10N4O4S/c17-8-5-15(6-9(18)13-8)11-7(1-2-10(19)20)16-3-4-21-12(16)14-11/h1-4H,5-6H2,(H,19,20)(H,13,17,18) |
| InChIKey | PYGKLGZOBXPAKA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|