C12H12N4O3S — CID 57367193
3-[6-(3-oxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid (PubChem CID 57367193) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[6-(3-oxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[6-(3-oxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 57367193 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-[6-(3-oxopiperazin-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1c(N2CCNC(=O)C2)nc2sccn12 |
| InChI | InChI=1S/C12H12N4O3S/c17-9-7-15(4-3-13-9)11-8(1-2-10(18)19)16-5-6-20-12(16)14-11/h1-2,5-6H,3-4,7H2,(H,13,17)(H,18,19) |
| InChIKey | IBPJZNIOVATSAO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|