C11H16N2O2S — CID 106325819
3-methyl-1-(2-thiomorpholin-4-ylethyl)pyrrole-2,5-dione (PubChem CID 106325819) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-methyl-1-(2-thiomorpholin-4-ylethyl)pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-(2-thiomorpholin-4-ylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 106325819 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-methyl-1-(2-thiomorpholin-4-ylethyl)pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCN2CCSCC2)C1=O |
| InChI | InChI=1S/C11H16N2O2S/c1-9-8-10(14)13(11(9)15)3-2-12-4-6-16-7-5-12/h8H,2-7H2,1H3 |
| InChIKey | WOJHGSPSSBKTRM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|