C12H18N2O5 — CID 129224231
N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 129224231) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 129224231 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(3-methyl-2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CC1=CC(=O)N(CCC(=O)NC(C)(CO)CO)C1=O |
| InChI | InChI=1S/C12H18N2O5/c1-8-5-10(18)14(11(8)19)4-3-9(17)13-12(2,6-15)7-16/h5,15-16H,3-4,6-7H2,1-2H3,(H,13,17) |
| InChIKey | ZMMIXHROKAZULH-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|