C13H20O4 — CID 10633790
[(4E,6S)-10-oxo-2-propyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate (PubChem CID 10633790) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is [(4E,6S)-10-oxo-2-propyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate.
| Compound Name | [(4E,6S)-10-oxo-2-propyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate |
|---|---|
| PubChem CID | 10633790 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [(4E,6S)-10-oxo-2-propyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate |
| SMILES | CCCC1C/C=C/[C@@H](OC=O)CCCC(=O)O1 |
| InChI | InChI=1S/C13H20O4/c1-2-5-12-8-3-6-11(16-10-14)7-4-9-13(15)17-12/h3,6,10-12H,2,4-5,7-9H2,1H3/b6-3+/t11-,12?/m1/s1 |
| InChIKey | RYCFTWMMQBFNBE-KLECNKGYSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|