C15H24O4 — CID 163006848
[(2S,4E,6S)-10-oxo-2-pentyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate (PubChem CID 163006848) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [(2S,4E,6S)-10-oxo-2-pentyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate.
| Compound Name | [(2S,4E,6S)-10-oxo-2-pentyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate |
|---|---|
| PubChem CID | 163006848 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(2S,4E,6S)-10-oxo-2-pentyl-2,3,6,7,8,9-hexahydrooxecin-6-yl] formate |
| SMILES | CCCCC[C@H]1C/C=C/[C@@H](OC=O)CCCC(=O)O1 |
| InChI | InChI=1S/C15H24O4/c1-2-3-4-7-14-10-5-8-13(18-12-16)9-6-11-15(17)19-14/h5,8,12-14H,2-4,6-7,9-11H2,1H3/b8-5+/t13-,14+/m1/s1 |
| InChIKey | MHDUAFWFDAUOML-AMVTZNPPSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|