C23H40O6 — CID 138975794
ethyl (E)-9-acetyloxy-5-(oxan-2-yloxy)tetradec-6-enoate (PubChem CID 138975794) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is ethyl (E)-9-acetyloxy-5-(oxan-2-yloxy)tetradec-6-enoate.
| Compound Name | ethyl (E)-9-acetyloxy-5-(oxan-2-yloxy)tetradec-6-enoate |
|---|---|
| PubChem CID | 138975794 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | ethyl (E)-9-acetyloxy-5-(oxan-2-yloxy)tetradec-6-enoate |
| SMILES | CCCCCC(C/C=C/C(CCCC(=O)OCC)OC1CCCCO1)OC(C)=O |
| InChI | InChI=1S/C23H40O6/c1-4-6-7-12-20(28-19(3)24)13-10-14-21(15-11-16-22(25)26-5-2)29-23-17-8-9-18-27-23/h10,14,20-21,23H,4-9,11-13,15-18H2,1-3H3/b14-10+ |
| InChIKey | VKYFYSITJIZWQQ-GXDHUFHOSA-N |
| XLogP | 5.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|