C26H40O4 — CID 135046053
methyl (5Z,10E,12S,14Z)-12-(oxan-2-yloxy)icosa-5,10,14-trien-8-ynoate (PubChem CID 135046053) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is methyl (5Z,10E,12S,14Z)-12-(oxan-2-yloxy)icosa-5,10,14-trien-8-ynoate.
| Compound Name | methyl (5Z,10E,12S,14Z)-12-(oxan-2-yloxy)icosa-5,10,14-trien-8-ynoate |
|---|---|
| PubChem CID | 135046053 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | methyl (5Z,10E,12S,14Z)-12-(oxan-2-yloxy)icosa-5,10,14-trien-8-ynoate |
| SMILES | CCCCC/C=C\C[C@@H](/C=C/C#CC/C=C\CCCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C26H40O4/c1-3-4-5-6-11-14-19-24(30-26-22-17-18-23-29-26)20-15-12-9-7-8-10-13-16-21-25(27)28-2/h8,10-11,14-15,20,24,26H,3-7,13,16-19,21-23H2,1-2H3/b10-8-,14-11-,20-15+/t24-,26?/m0/s1 |
| InChIKey | HASJBAOYTVBRJJ-MOGOKICMSA-N |
| XLogP | 6.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|