C26H44O4 — CID 59098326
methyl (Z,16R)-16-(oxan-2-yloxy)icos-14-en-5-ynoate (PubChem CID 59098326) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is methyl (Z,16R)-16-(oxan-2-yloxy)icos-14-en-5-ynoate.
| Compound Name | methyl (Z,16R)-16-(oxan-2-yloxy)icos-14-en-5-ynoate |
|---|---|
| PubChem CID | 59098326 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | methyl (Z,16R)-16-(oxan-2-yloxy)icos-14-en-5-ynoate |
| SMILES | CCCC[C@H](/C=C\CCCCCCCC#CCCCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C26H44O4/c1-3-4-19-24(30-26-22-17-18-23-29-26)20-15-13-11-9-7-5-6-8-10-12-14-16-21-25(27)28-2/h15,20,24,26H,3-9,11,13-14,16-19,21-23H2,1-2H3/b20-15-/t24-,26?/m1/s1 |
| InChIKey | LXNJZWAYCKLIRF-BCAAMOKKSA-N |
| XLogP | 6.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|