C24H38O5 — CID 134880563
[(5S,6E,10E)-2-hydroxy-2,6-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate (PubChem CID 134880563) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(5S,6E,10E)-2-hydroxy-2,6-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [(5S,6E,10E)-2-hydroxy-2,6-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134880563 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(5S,6E,10E)-2-hydroxy-2,6-dimethyl-12-(oxan-2-yloxy)dodeca-6,10-dien-3-yn-5-yl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\CC/C=C/COC1CCCCO1)[C@@H](C#CC(C)(C)O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H38O5/c1-19(13-9-7-8-11-17-27-21-14-10-12-18-28-21)20(15-16-24(5,6)26)29-22(25)23(2,3)4/h8,11,13,20-21,26H,7,9-10,12,14,17-18H2,1-6H3/b11-8+,19-13+/t20-,21?/m1/s1 |
| InChIKey | NDWCJSBKPNQNRK-FDCDLMHZSA-N |
| XLogP | 4.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|