C24H38O5 — CID 134930930
[(2S)-5,5-dimethyl-2-[(2E,6E)-8-(oxan-2-yloxy)octa-2,6-dien-2-yl]-2H-furan-4-yl] 2,2-dimethylpropanoate (PubChem CID 134930930) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(2S)-5,5-dimethyl-2-[(2E,6E)-8-(oxan-2-yloxy)octa-2,6-dien-2-yl]-2H-furan-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-5,5-dimethyl-2-[(2E,6E)-8-(oxan-2-yloxy)octa-2,6-dien-2-yl]-2H-furan-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134930930 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(2S)-5,5-dimethyl-2-[(2E,6E)-8-(oxan-2-yloxy)octa-2,6-dien-2-yl]-2H-furan-4-yl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\CC/C=C/COC1CCCCO1)[C@@H]1C=C(OC(=O)C(C)(C)C)C(C)(C)O1 |
| InChI | InChI=1S/C24H38O5/c1-18(13-9-7-8-11-15-26-21-14-10-12-16-27-21)19-17-20(24(5,6)29-19)28-22(25)23(2,3)4/h8,11,13,17,19,21H,7,9-10,12,14-16H2,1-6H3/b11-8+,18-13+/t19-,21?/m0/s1 |
| InChIKey | LWHPNIALKKFZGW-DQTXRWDDSA-N |
| XLogP | 5.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|