C8H14N4O4S3 — CID 106339455
2-[[5-[3-(methanesulfonamido)propylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 106339455) has the molecular formula C8H14N4O4S3 and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[[5-[3-(methanesulfonamido)propylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(methanesulfonamido)propylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 106339455 |
| Molecular Formula | C8H14N4O4S3 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-[[5-[3-(methanesulfonamido)propylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | CS(=O)(=O)NCCCNc1nnc(SCC(=O)O)s1 |
| InChI | InChI=1S/C8H14N4O4S3/c1-19(15,16)10-4-2-3-9-7-11-12-8(18-7)17-5-6(13)14/h10H,2-5H2,1H3,(H,9,11)(H,13,14) |
| InChIKey | IKOLTCJSWXJJNB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|