C17H16O3 — CID 10635591
5,7-dimethoxy-2-phenyl-2H-chromene (PubChem CID 10635591) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 5,7-dimethoxy-2-phenyl-2H-chromene.
| Compound Name | 5,7-dimethoxy-2-phenyl-2H-chromene |
|---|---|
| PubChem CID | 10635591 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5,7-dimethoxy-2-phenyl-2H-chromene |
| SMILES | COc1cc(OC)c2c(c1)OC(c1ccccc1)C=C2 |
| InChI | InChI=1S/C17H16O3/c1-18-13-10-16(19-2)14-8-9-15(20-17(14)11-13)12-6-4-3-5-7-12/h3-11,15H,1-2H3 |
| InChIKey | XTZYRKOKKXRLNP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |