C18H20O2 — CID 10635615
(3R,7S,8R,9R)-9-phenyl-5-oxatetracyclo[6.5.0.01,9.03,7]tridecan-6-one (PubChem CID 10635615) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3R,7S,8R,9R)-9-phenyl-5-oxatetracyclo[6.5.0.01,9.03,7]tridecan-6-one.
| Compound Name | (3R,7S,8R,9R)-9-phenyl-5-oxatetracyclo[6.5.0.01,9.03,7]tridecan-6-one |
|---|---|
| PubChem CID | 10635615 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (3R,7S,8R,9R)-9-phenyl-5-oxatetracyclo[6.5.0.01,9.03,7]tridecan-6-one |
| SMILES | O=C1OC[C@@H]2CC34CCCC[C@@]3(c3ccccc3)[C@@H]4[C@H]12 |
| InChI | InChI=1S/C18H20O2/c19-16-14-12(11-20-16)10-17-8-4-5-9-18(17,15(14)17)13-6-2-1-3-7-13/h1-3,6-7,12,14-15H,4-5,8-11H2/t12-,14+,15+,17?,18+/m0/s1 |
| InChIKey | LUFZSCYXIHEIMY-OHTIOOIGSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |