C14H15F3N2S — CID 106362670
N-(2,3,4-trifluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106362670) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(2,3,4-trifluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106362670 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | Fc1ccc(NC2=NC3CCCCC3CS2)c(F)c1F |
| InChI | InChI=1S/C14H15F3N2S/c15-9-5-6-11(13(17)12(9)16)19-14-18-10-4-2-1-3-8(10)7-20-14/h5-6,8,10H,1-4,7H2,(H,18,19) |
| InChIKey | CGQDAIORXCNQRV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|