C14H16BrClN2S — CID 106362847
N-(4-bromo-2-chlorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106362847) has the molecular formula C14H16BrClN2S and a molecular weight of 359.72 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(4-bromo-2-chlorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106362847 |
| Molecular Formula | C14H16BrClN2S |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | Clc1cc(Br)ccc1NC1=NC2CCCCC2CS1 |
| InChI | InChI=1S/C14H16BrClN2S/c15-10-5-6-13(11(16)7-10)18-14-17-12-4-2-1-3-9(12)8-19-14/h5-7,9,12H,1-4,8H2,(H,17,18) |
| InChIKey | NEKBQIWWEJDDAK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |