C14H15Cl2FN2S — CID 106363814
N-(3,5-dichloro-4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine (PubChem CID 106363814) has the molecular formula C14H15Cl2FN2S and a molecular weight of 333.26 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 106363814 |
| Molecular Formula | C14H15Cl2FN2S |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
| SMILES | Fc1c(Cl)cc(NC2=NC3CCCCC3CS2)cc1Cl |
| InChI | InChI=1S/C14H15Cl2FN2S/c15-10-5-9(6-11(16)13(10)17)18-14-19-12-4-2-1-3-8(12)7-20-14/h5-6,8,12H,1-4,7H2,(H,18,19) |
| InChIKey | RDEZXIVURYJDHS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|