C13H14BrFN2S — CID 106363400
N-(4-bromo-3-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 106363400) has the molecular formula C13H14BrFN2S and a molecular weight of 329.24 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-(4-bromo-3-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 106363400 |
| Molecular Formula | C13H14BrFN2S |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | Fc1cc(NC2=NC3CCCC3CS2)ccc1Br |
| InChI | InChI=1S/C13H14BrFN2S/c14-10-5-4-9(6-11(10)15)16-13-17-12-3-1-2-8(12)7-18-13/h4-6,8,12H,1-3,7H2,(H,16,17) |
| InChIKey | MKIZBWODUPDJAO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |