C15H19N3OS — CID 106362736
N-[3-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)phenyl]acetamide (PubChem CID 106362736) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[3-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)phenyl]acetamide.
| Compound Name | N-[3-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 106362736 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[3-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC2=NC3CCCC3CS2)c1 |
| InChI | InChI=1S/C15H19N3OS/c1-10(19)16-12-5-3-6-13(8-12)17-15-18-14-7-2-4-11(14)9-20-15/h3,5-6,8,11,14H,2,4,7,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | HSYBXPHXDKOUAU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |