C13H14Br2N2S — CID 106362987
N-(2,4-dibromophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 106362987) has the molecular formula C13H14Br2N2S and a molecular weight of 390.14 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-(2,4-dibromophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 106362987 |
| Molecular Formula | C13H14Br2N2S |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | N-(2,4-dibromophenyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | Brc1ccc(NC2=NC3CCCC3CS2)c(Br)c1 |
| InChI | InChI=1S/C13H14Br2N2S/c14-9-4-5-12(10(15)6-9)17-13-16-11-3-1-2-8(11)7-18-13/h4-6,8,11H,1-3,7H2,(H,16,17) |
| InChIKey | VPSAZRUZRHJZNV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |